Mebendazole API Intermediates Cas 31431-39-7

Mebendazole API Intermediates Cas 31431-39-7

Mebendazole API Intermediates Cas 31431-39-7 is an intermediate that can be used as an anthelmintic. In vivo or in vitro tests have been shown to directly inhibit the ingestion of glucose by nematodes, leading to depletion of glycogen and rendering it inoperable.

Chat Now

Product Details

Mebendazole API Intermediates Cas 31431-39-7 is an intermediate that can be used as an anthelmintic. In vivo or in vitro tests have been shown to directly inhibit the ingestion of glucose by nematodes, leading to depletion of glycogen and rendering it inoperable. Therefore, the drug has a significant effect of killing larvae and inhibiting the development of eggs, but does not affect blood sugar levels in the human body. It can be used to control intestinal parasitic diseases such as hookworms, mites, whipworms, and faecalis.

Mebendazole is also an oxidative phosphorylation uncoupling agent, which inhibits fumarate reductase in mitochondria and reduces glucose transport, thereby affecting ATP production.


Mebendazole API Intermediates Cas 31431-39-7

Appearance and traits: white to light yellow powder

Density: 1.388g/cm3

Melting point: 288.5 ° C

Refractive index: 1.702

Storage conditions: 0-6oC


Category: API

CAS NO: 31431-39-7

EC NO: 250-635-4

Molecular Formula: C16H13N3O3

Molecular Weight: 295.2927

Specification: EP/USP/CP

InChI: InChI=1/C16H13N3O3/c1-22-16(21)19-15-17-12-8-7-11(9-13(12)18-15)14(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,17,18,19,21)

Synonyms:

methyl 5-benzoylbenzimidazol-2-ylcarbamate;

methyl 5-benzoylbenzimidazole-2-carbamate;

methyl (6-benzoyl-1H-benzimidazol-2-yl)carbamate;


Molecular Structure:

The main usage

1. As an anthelmintic, it is effective against animal gastrointestinal nematodes and can be mixed with feed.

2. As an anthelmintic drug, it has curative effect on a variety of intestinal worms such as aphids, whipworms, hookworms, etc., and is the preferred anti-whipworm drug.

Previous:No Information Next:Progesterone API Intermediates Cas 57-83-0

Inquiry